C16H24ClNO2 — CID 104664905
N-[(5-chloro-3-methoxy-2-pent-4-enoxyphenyl)methyl]propan-2-amine (PubChem CID 104664905) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is N-[(5-chloro-3-methoxy-2-pent-4-enoxyphenyl)methyl]propan-2-amine.
| Compound Name | N-[(5-chloro-3-methoxy-2-pent-4-enoxyphenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 104664905 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(5-chloro-3-methoxy-2-pent-4-enoxyphenyl)methyl]propan-2-amine |
| SMILES | C=CCCCOc1c(CNC(C)C)cc(Cl)cc1OC |
| InChI | InChI=1S/C16H24ClNO2/c1-5-6-7-8-20-16-13(11-18-12(2)3)9-14(17)10-15(16)19-4/h5,9-10,12,18H,1,6-8,11H2,2-4H3 |
| InChIKey | GHBVRNCUJVGDTO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|