C15H21F2NO — CID 79892106
N-[(3,5-difluoro-4-pent-4-enoxyphenyl)methyl]propan-2-amine (PubChem CID 79892106) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is N-[(3,5-difluoro-4-pent-4-enoxyphenyl)methyl]propan-2-amine.
| Compound Name | N-[(3,5-difluoro-4-pent-4-enoxyphenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 79892106 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-[(3,5-difluoro-4-pent-4-enoxyphenyl)methyl]propan-2-amine |
| SMILES | C=CCCCOc1c(F)cc(CNC(C)C)cc1F |
| InChI | InChI=1S/C15H21F2NO/c1-4-5-6-7-19-15-13(16)8-12(9-14(15)17)10-18-11(2)3/h4,8-9,11,18H,1,5-7,10H2,2-3H3 |
| InChIKey | VZIBAZBQAPJZML-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|