C11H13F2NO3S — CID 82919223
3,5-difluoro-4-pent-4-enoxybenzenesulfonamide (PubChem CID 82919223) has the molecular formula C11H13F2NO3S and a molecular weight of 277.29 g/mol. Its IUPAC name is 3,5-difluoro-4-pent-4-enoxybenzenesulfonamide.
| Compound Name | 3,5-difluoro-4-pent-4-enoxybenzenesulfonamide |
|---|---|
| PubChem CID | 82919223 |
| Molecular Formula | C11H13F2NO3S |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3,5-difluoro-4-pent-4-enoxybenzenesulfonamide |
| SMILES | C=CCCCOc1c(F)cc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C11H13F2NO3S/c1-2-3-4-5-17-11-9(12)6-8(7-10(11)13)18(14,15)16/h2,6-7H,1,3-5H2,(H2,14,15,16) |
| InChIKey | GZEWYKCZHHCEIG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|