About 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide
4-but-3-enoxy-3,5-dimethylbenzenesulfonamide (PubChem CID 82913781) has the molecular formula C12H17NO3S
and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide |
| PubChem CID | 82913781 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide |
| SMILES | C=CCCOc1c(C)cc(S(N)(=O)=O)cc1C |
| InChI | InChI=1S/C12H17NO3S/c1-4-5-6-16-12-9(2)7-11(8-10(12)3)17(13,14)15/h4,7-8H,1,5-6H2,2-3H3,(H2,13,14,15) |
| InChIKey | HVZFVTOTJMYTFA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide?
The IUPAC name of 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide (CID 82913781) is 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide.
What is the SMILES notation for 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide?
The canonical SMILES for 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide is C=CCCOc1c(C)cc(S(N)(=O)=O)cc1C.
What is the InChIKey of 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide?
The InChIKey is HVZFVTOTJMYTFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3S/c1-4-5-6-16-12-9(2)7-11(8-10(12)3)17(13,14)15/h4,7-8H,1,5-6H2,2-3H3,(H2,13,14,15).
What are the key properties of 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide?
4-but-3-enoxy-3,5-dimethylbenzenesulfonamide has a molecular weight of 255.34 g/mol, XLogP of 1.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-enoxy-3,5-dimethylbenzenesulfonamide is sourced from PubChem (CID 82913781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).