C15H23NO4S — CID 65163200
3,5-dimethyl-4-[3-(oxolan-2-yl)propoxy]benzenesulfonamide (PubChem CID 65163200) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 3,5-dimethyl-4-[3-(oxolan-2-yl)propoxy]benzenesulfonamide.
| Compound Name | 3,5-dimethyl-4-[3-(oxolan-2-yl)propoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 65163200 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3,5-dimethyl-4-[3-(oxolan-2-yl)propoxy]benzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(C)c1OCCCC1CCCO1 |
| InChI | InChI=1S/C15H23NO4S/c1-11-9-14(21(16,17)18)10-12(2)15(11)20-8-4-6-13-5-3-7-19-13/h9-10,13H,3-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | ACDQFVBRWOJLCA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|