C15H21ClO4S — CID 65163378
2,6-dimethyl-4-[3-(oxolan-2-yl)propoxy]benzenesulfonyl chloride (PubChem CID 65163378) has the molecular formula C15H21ClO4S and a molecular weight of 332.85 g/mol. Its IUPAC name is 2,6-dimethyl-4-[3-(oxolan-2-yl)propoxy]benzenesulfonyl chloride.
| Compound Name | 2,6-dimethyl-4-[3-(oxolan-2-yl)propoxy]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65163378 |
| Molecular Formula | C15H21ClO4S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2,6-dimethyl-4-[3-(oxolan-2-yl)propoxy]benzenesulfonyl chloride |
| SMILES | Cc1cc(OCCCC2CCCO2)cc(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C15H21ClO4S/c1-11-9-14(10-12(2)15(11)21(16,17)18)20-8-4-6-13-5-3-7-19-13/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | OXBBFEHULVJFPJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|