C14H19ClO4S — CID 65163699
2,3-dimethyl-4-[2-(oxolan-2-yl)ethoxy]benzenesulfonyl chloride (PubChem CID 65163699) has the molecular formula C14H19ClO4S and a molecular weight of 318.82 g/mol. Its IUPAC name is 2,3-dimethyl-4-[2-(oxolan-2-yl)ethoxy]benzenesulfonyl chloride.
| Compound Name | 2,3-dimethyl-4-[2-(oxolan-2-yl)ethoxy]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65163699 |
| Molecular Formula | C14H19ClO4S |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2,3-dimethyl-4-[2-(oxolan-2-yl)ethoxy]benzenesulfonyl chloride |
| SMILES | Cc1c(OCCC2CCCO2)ccc(S(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C14H19ClO4S/c1-10-11(2)14(20(15,16)17)6-5-13(10)19-9-7-12-4-3-8-18-12/h5-6,12H,3-4,7-9H2,1-2H3 |
| InChIKey | IXSKLNVJXRQHEK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |