C12H15Br2NO4S — CID 65162551
3,5-dibromo-4-[2-(oxolan-2-yl)ethoxy]benzenesulfonamide (PubChem CID 65162551) has the molecular formula C12H15Br2NO4S and a molecular weight of 429.13 g/mol. Its IUPAC name is 3,5-dibromo-4-[2-(oxolan-2-yl)ethoxy]benzenesulfonamide.
| Compound Name | 3,5-dibromo-4-[2-(oxolan-2-yl)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 65162551 |
| Molecular Formula | C12H15Br2NO4S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 426.91 |
| IUPAC Name | 3,5-dibromo-4-[2-(oxolan-2-yl)ethoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)c(OCCC2CCCO2)c(Br)c1 |
| InChI | InChI=1S/C12H15Br2NO4S/c13-10-6-9(20(15,16)17)7-11(14)12(10)19-5-3-8-2-1-4-18-8/h6-8H,1-5H2,(H2,15,16,17) |
| InChIKey | WNYKZDICMAITSL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |