C12H15Cl2NO2 — CID 65159099
3,5-dichloro-4-[2-(oxolan-2-yl)ethoxy]aniline (PubChem CID 65159099) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is 3,5-dichloro-4-[2-(oxolan-2-yl)ethoxy]aniline.
| Compound Name | 3,5-dichloro-4-[2-(oxolan-2-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 65159099 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 3,5-dichloro-4-[2-(oxolan-2-yl)ethoxy]aniline |
| SMILES | Nc1cc(Cl)c(OCCC2CCCO2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO2/c13-10-6-8(15)7-11(14)12(10)17-5-3-9-2-1-4-16-9/h6-7,9H,1-5,15H2 |
| InChIKey | IAVWLFUZWDKCPR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|