C14H19BrO4 — CID 65162786
[3-bromo-5-methoxy-4-[2-(oxolan-2-yl)ethoxy]phenyl]methanol (PubChem CID 65162786) has the molecular formula C14H19BrO4 and a molecular weight of 331.21 g/mol. Its IUPAC name is [3-bromo-5-methoxy-4-[2-(oxolan-2-yl)ethoxy]phenyl]methanol.
| Compound Name | [3-bromo-5-methoxy-4-[2-(oxolan-2-yl)ethoxy]phenyl]methanol |
|---|---|
| PubChem CID | 65162786 |
| Molecular Formula | C14H19BrO4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | [3-bromo-5-methoxy-4-[2-(oxolan-2-yl)ethoxy]phenyl]methanol |
| SMILES | COc1cc(CO)cc(Br)c1OCCC1CCCO1 |
| InChI | InChI=1S/C14H19BrO4/c1-17-13-8-10(9-16)7-12(15)14(13)19-6-4-11-3-2-5-18-11/h7-8,11,16H,2-6,9H2,1H3 |
| InChIKey | RUVZOHBJPIVKOI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |