C14H20BrNO4 — CID 79171963
[3-bromo-5-methoxy-4-[(4-methylmorpholin-2-yl)methoxy]phenyl]methanol (PubChem CID 79171963) has the molecular formula C14H20BrNO4 and a molecular weight of 346.22 g/mol. Its IUPAC name is [3-bromo-5-methoxy-4-[(4-methylmorpholin-2-yl)methoxy]phenyl]methanol.
| Compound Name | [3-bromo-5-methoxy-4-[(4-methylmorpholin-2-yl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 79171963 |
| Molecular Formula | C14H20BrNO4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | [3-bromo-5-methoxy-4-[(4-methylmorpholin-2-yl)methoxy]phenyl]methanol |
| SMILES | COc1cc(CO)cc(Br)c1OCC1CN(C)CCO1 |
| InChI | InChI=1S/C14H20BrNO4/c1-16-3-4-19-11(7-16)9-20-14-12(15)5-10(8-17)6-13(14)18-2/h5-6,11,17H,3-4,7-9H2,1-2H3 |
| InChIKey | UUJGFZNKTSURLK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |