C13H15BrO5 — CID 43622570
3-bromo-5-methoxy-4-(oxolan-2-ylmethoxy)benzoic acid (PubChem CID 43622570) has the molecular formula C13H15BrO5 and a molecular weight of 331.16 g/mol. Its IUPAC name is 3-bromo-5-methoxy-4-(oxolan-2-ylmethoxy)benzoic acid.
| Compound Name | 3-bromo-5-methoxy-4-(oxolan-2-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 43622570 |
| Molecular Formula | C13H15BrO5 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 3-bromo-5-methoxy-4-(oxolan-2-ylmethoxy)benzoic acid |
| SMILES | COc1cc(C(=O)O)cc(Br)c1OCC1CCCO1 |
| InChI | InChI=1S/C13H15BrO5/c1-17-11-6-8(13(15)16)5-10(14)12(11)19-7-9-3-2-4-18-9/h5-6,9H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | SVEXAWKFENMTRX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |