C15H17ClO5 — CID 104666607
(E)-3-[5-chloro-3-methoxy-2-(oxolan-2-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 104666607) has the molecular formula C15H17ClO5 and a molecular weight of 312.75 g/mol. Its IUPAC name is (E)-3-[5-chloro-3-methoxy-2-(oxolan-2-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-chloro-3-methoxy-2-(oxolan-2-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104666607 |
| Molecular Formula | C15H17ClO5 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (E)-3-[5-chloro-3-methoxy-2-(oxolan-2-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1cc(Cl)cc(/C=C/C(=O)O)c1OCC1CCCO1 |
| InChI | InChI=1S/C15H17ClO5/c1-19-13-8-11(16)7-10(4-5-14(17)18)15(13)21-9-12-3-2-6-20-12/h4-5,7-8,12H,2-3,6,9H2,1H3,(H,17,18)/b5-4+ |
| InChIKey | OENUMLWAGRBLLW-SNAWJCMRSA-N |
| XLogP | 3.00 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|