C15H20ClNO4 — CID 104665518
5-chloro-2-[(4-ethylmorpholin-2-yl)methoxy]-3-methoxybenzaldehyde (PubChem CID 104665518) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 5-chloro-2-[(4-ethylmorpholin-2-yl)methoxy]-3-methoxybenzaldehyde.
| Compound Name | 5-chloro-2-[(4-ethylmorpholin-2-yl)methoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 104665518 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 5-chloro-2-[(4-ethylmorpholin-2-yl)methoxy]-3-methoxybenzaldehyde |
| SMILES | CCN1CCOC(COc2c(C=O)cc(Cl)cc2OC)C1 |
| InChI | InChI=1S/C15H20ClNO4/c1-3-17-4-5-20-13(8-17)10-21-15-11(9-18)6-12(16)7-14(15)19-2/h6-7,9,13H,3-5,8,10H2,1-2H3 |
| InChIKey | CVUGPZMVWFPJGP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|