C15H23ClN2O3 — CID 79164835
4-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-2,5-dimethoxyaniline (PubChem CID 79164835) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is 4-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-2,5-dimethoxyaniline.
| Compound Name | 4-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 79164835 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-2,5-dimethoxyaniline |
| SMILES | CCN1CCOC(CNc2cc(OC)c(Cl)cc2OC)C1 |
| InChI | InChI=1S/C15H23ClN2O3/c1-4-18-5-6-21-11(10-18)9-17-13-8-14(19-2)12(16)7-15(13)20-3/h7-8,11,17H,4-6,9-10H2,1-3H3 |
| InChIKey | WTQMGLVAMPMZPG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |