C13H17Cl3N2O — CID 79164415
2,4,6-trichloro-N-[(4-ethylmorpholin-2-yl)methyl]aniline (PubChem CID 79164415) has the molecular formula C13H17Cl3N2O and a molecular weight of 323.65 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(4-ethylmorpholin-2-yl)methyl]aniline.
| Compound Name | 2,4,6-trichloro-N-[(4-ethylmorpholin-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 79164415 |
| Molecular Formula | C13H17Cl3N2O |
| Molecular Weight | 323.65 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2,4,6-trichloro-N-[(4-ethylmorpholin-2-yl)methyl]aniline |
| SMILES | CCN1CCOC(CNc2c(Cl)cc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C13H17Cl3N2O/c1-2-18-3-4-19-10(8-18)7-17-13-11(15)5-9(14)6-12(13)16/h5-6,10,17H,2-4,7-8H2,1H3 |
| InChIKey | MAAHEQIHOTWZSG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |