C13H18ClFN2O — CID 79164853
2-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-4-fluoroaniline (PubChem CID 79164853) has the molecular formula C13H18ClFN2O and a molecular weight of 272.75 g/mol. Its IUPAC name is 2-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-4-fluoroaniline.
| Compound Name | 2-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 79164853 |
| Molecular Formula | C13H18ClFN2O |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-4-fluoroaniline |
| SMILES | CCN1CCOC(CNc2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C13H18ClFN2O/c1-2-17-5-6-18-11(9-17)8-16-13-4-3-10(15)7-12(13)14/h3-4,7,11,16H,2,5-6,8-9H2,1H3 |
| InChIKey | PWXHUMFPYHRQFF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |