C12H17ClFN3O — CID 115681758
5-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-3-fluoropyridin-2-amine (PubChem CID 115681758) has the molecular formula C12H17ClFN3O and a molecular weight of 273.74 g/mol. Its IUPAC name is 5-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-3-fluoropyridin-2-amine.
| Compound Name | 5-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 115681758 |
| Molecular Formula | C12H17ClFN3O |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 5-chloro-N-[(4-ethylmorpholin-2-yl)methyl]-3-fluoropyridin-2-amine |
| SMILES | CCN1CCOC(CNc2ncc(Cl)cc2F)C1 |
| InChI | InChI=1S/C12H17ClFN3O/c1-2-17-3-4-18-10(8-17)7-16-12-11(14)5-9(13)6-15-12/h5-6,10H,2-4,7-8H2,1H3,(H,15,16) |
| InChIKey | QUWVXQXMNBFXSY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |