C12H10ClNO4 — CID 104665448
5-chloro-3-methoxy-2-(1,2-oxazol-5-ylmethoxy)benzaldehyde (PubChem CID 104665448) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is 5-chloro-3-methoxy-2-(1,2-oxazol-5-ylmethoxy)benzaldehyde.
| Compound Name | 5-chloro-3-methoxy-2-(1,2-oxazol-5-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 104665448 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 5-chloro-3-methoxy-2-(1,2-oxazol-5-ylmethoxy)benzaldehyde |
| SMILES | COc1cc(Cl)cc(C=O)c1OCc1ccno1 |
| InChI | InChI=1S/C12H10ClNO4/c1-16-11-5-9(13)4-8(6-15)12(11)17-7-10-2-3-14-18-10/h2-6H,7H2,1H3 |
| InChIKey | ZOXGBCBOLPEXJQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|