C13H15ClO5 — CID 113438784
3-(4-chloro-2-formyl-6-methoxyphenoxy)-2,2-dimethylpropanoic acid (PubChem CID 113438784) has the molecular formula C13H15ClO5 and a molecular weight of 286.71 g/mol. Its IUPAC name is 3-(4-chloro-2-formyl-6-methoxyphenoxy)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(4-chloro-2-formyl-6-methoxyphenoxy)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 113438784 |
| Molecular Formula | C13H15ClO5 |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-(4-chloro-2-formyl-6-methoxyphenoxy)-2,2-dimethylpropanoic acid |
| SMILES | COc1cc(Cl)cc(C=O)c1OCC(C)(C)C(=O)O |
| InChI | InChI=1S/C13H15ClO5/c1-13(2,12(16)17)7-19-11-8(6-15)4-9(14)5-10(11)18-3/h4-6H,7H2,1-3H3,(H,16,17) |
| InChIKey | OQVOEVXSNFRPQK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|