C12H10ClNO3S — CID 113438752
5-chloro-3-methoxy-2-(1,3-thiazol-2-ylmethoxy)benzaldehyde (PubChem CID 113438752) has the molecular formula C12H10ClNO3S and a molecular weight of 283.74 g/mol. Its IUPAC name is 5-chloro-3-methoxy-2-(1,3-thiazol-2-ylmethoxy)benzaldehyde.
| Compound Name | 5-chloro-3-methoxy-2-(1,3-thiazol-2-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 113438752 |
| Molecular Formula | C12H10ClNO3S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 5-chloro-3-methoxy-2-(1,3-thiazol-2-ylmethoxy)benzaldehyde |
| SMILES | COc1cc(Cl)cc(C=O)c1OCc1nccs1 |
| InChI | InChI=1S/C12H10ClNO3S/c1-16-10-5-9(13)4-8(6-15)12(10)17-7-11-14-2-3-18-11/h2-6H,7H2,1H3 |
| InChIKey | APVMHTBLKQNQBE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|