C11H8ClNO2S — CID 112611324
3-chloro-2-(1,3-thiazol-2-ylmethoxy)benzaldehyde (PubChem CID 112611324) has the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. Its IUPAC name is 3-chloro-2-(1,3-thiazol-2-ylmethoxy)benzaldehyde.
| Compound Name | 3-chloro-2-(1,3-thiazol-2-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 112611324 |
| Molecular Formula | C11H8ClNO2S |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 3-chloro-2-(1,3-thiazol-2-ylmethoxy)benzaldehyde |
| SMILES | O=Cc1cccc(Cl)c1OCc1nccs1 |
| InChI | InChI=1S/C11H8ClNO2S/c12-9-3-1-2-8(6-14)11(9)15-7-10-13-4-5-16-10/h1-6H,7H2 |
| InChIKey | MIKQRWYNTXCZME-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|