C14H18ClNO4 — CID 104665290
4-(4-chloro-2-formyl-6-methoxyphenoxy)-N,N-dimethylbutanamide (PubChem CID 104665290) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is 4-(4-chloro-2-formyl-6-methoxyphenoxy)-N,N-dimethylbutanamide.
| Compound Name | 4-(4-chloro-2-formyl-6-methoxyphenoxy)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 104665290 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-(4-chloro-2-formyl-6-methoxyphenoxy)-N,N-dimethylbutanamide |
| SMILES | COc1cc(Cl)cc(C=O)c1OCCCC(=O)N(C)C |
| InChI | InChI=1S/C14H18ClNO4/c1-16(2)13(18)5-4-6-20-14-10(9-17)7-11(15)8-12(14)19-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | VMCSXPHIWJBXAF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|