C15H20ClNO4 — CID 104665319
2-(4-chloro-2-formyl-6-methoxyphenoxy)-N-(3-methylbutyl)acetamide (PubChem CID 104665319) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-(4-chloro-2-formyl-6-methoxyphenoxy)-N-(3-methylbutyl)acetamide.
| Compound Name | 2-(4-chloro-2-formyl-6-methoxyphenoxy)-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 104665319 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-(4-chloro-2-formyl-6-methoxyphenoxy)-N-(3-methylbutyl)acetamide |
| SMILES | COc1cc(Cl)cc(C=O)c1OCC(=O)NCCC(C)C |
| InChI | InChI=1S/C15H20ClNO4/c1-10(2)4-5-17-14(19)9-21-15-11(8-18)6-12(16)7-13(15)20-3/h6-8,10H,4-5,9H2,1-3H3,(H,17,19) |
| InChIKey | WIVDZGXCYFOCBC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|