C13H15F2NO3 — CID 79891319
4-(2,6-difluoro-4-formylphenoxy)-N,N-dimethylbutanamide (PubChem CID 79891319) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-formylphenoxy)-N,N-dimethylbutanamide.
| Compound Name | 4-(2,6-difluoro-4-formylphenoxy)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 79891319 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-(2,6-difluoro-4-formylphenoxy)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCOc1c(F)cc(C=O)cc1F |
| InChI | InChI=1S/C13H15F2NO3/c1-16(2)12(18)4-3-5-19-13-10(14)6-9(8-17)7-11(13)15/h6-8H,3-5H2,1-2H3 |
| InChIKey | BHURCNUEYAZAEK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|