C13H18FNO3 — CID 112613189
4-[2-fluoro-6-(hydroxymethyl)phenoxy]-N,N-dimethylbutanamide (PubChem CID 112613189) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is 4-[2-fluoro-6-(hydroxymethyl)phenoxy]-N,N-dimethylbutanamide.
| Compound Name | 4-[2-fluoro-6-(hydroxymethyl)phenoxy]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 112613189 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 4-[2-fluoro-6-(hydroxymethyl)phenoxy]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCOc1c(F)cccc1CO |
| InChI | InChI=1S/C13H18FNO3/c1-15(2)12(17)7-4-8-18-13-10(9-16)5-3-6-11(13)14/h3,5-6,16H,4,7-9H2,1-2H3 |
| InChIKey | ORJWNZCANJHPFV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|