C16H19NO2 — CID 60769263
N,N-dimethyl-4-naphthalen-1-yloxybutanamide (PubChem CID 60769263) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N,N-dimethyl-4-naphthalen-1-yloxybutanamide.
| Compound Name | N,N-dimethyl-4-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 60769263 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N,N-dimethyl-4-naphthalen-1-yloxybutanamide |
| SMILES | CN(C)C(=O)CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C16H19NO2/c1-17(2)16(18)11-6-12-19-15-10-5-8-13-7-3-4-9-14(13)15/h3-5,7-10H,6,11-12H2,1-2H3 |
| InChIKey | IGCJRQNWNUMQIM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|