About 1-butoxynaphthalene
1-butoxynaphthalene (PubChem CID 13262700) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-butoxynaphthalene.
Molecular Properties
| Compound Name | 1-butoxynaphthalene |
| PubChem CID | 13262700 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-butoxynaphthalene |
| SMILES | CCCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C14H16O/c1-2-3-11-15-14-10-6-8-12-7-4-5-9-13(12)14/h4-10H,2-3,11H2,1H3 |
| InChIKey | RBITXBWPKRSPEO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxynaphthalene?
The IUPAC name of 1-butoxynaphthalene (CID 13262700) is 1-butoxynaphthalene.
What is the SMILES notation for 1-butoxynaphthalene?
The canonical SMILES for 1-butoxynaphthalene is CCCCOc1cccc2ccccc12.
What is the InChIKey of 1-butoxynaphthalene?
The InChIKey is RBITXBWPKRSPEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O/c1-2-3-11-15-14-10-6-8-12-7-4-5-9-13(12)14/h4-10H,2-3,11H2,1H3.
What are the key properties of 1-butoxynaphthalene?
1-butoxynaphthalene has a molecular weight of 200.28 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxynaphthalene is sourced from PubChem (CID 13262700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).