About 1-butoxy-6,7-difluoronaphthalene
1-butoxy-6,7-difluoronaphthalene (PubChem CID 70812007) has the molecular formula C14H14F2O
and a molecular weight of 236.26 g/mol. Its IUPAC name is 1-butoxy-6,7-difluoronaphthalene.
Molecular Properties
| Compound Name | 1-butoxy-6,7-difluoronaphthalene |
| PubChem CID | 70812007 |
| Molecular Formula | C14H14F2O |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-butoxy-6,7-difluoronaphthalene |
| SMILES | CCCCOc1cccc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C14H14F2O/c1-2-3-7-17-14-6-4-5-10-8-12(15)13(16)9-11(10)14/h4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | IHHPBRHSJNJCRW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-6,7-difluoronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-6,7-difluoronaphthalene?
The IUPAC name of 1-butoxy-6,7-difluoronaphthalene (CID 70812007) is 1-butoxy-6,7-difluoronaphthalene.
What is the SMILES notation for 1-butoxy-6,7-difluoronaphthalene?
The canonical SMILES for 1-butoxy-6,7-difluoronaphthalene is CCCCOc1cccc2cc(F)c(F)cc12.
What is the InChIKey of 1-butoxy-6,7-difluoronaphthalene?
The InChIKey is IHHPBRHSJNJCRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2O/c1-2-3-7-17-14-6-4-5-10-8-12(15)13(16)9-11(10)14/h4-6,8-9H,2-3,7H2,1H3.
What are the key properties of 1-butoxy-6,7-difluoronaphthalene?
1-butoxy-6,7-difluoronaphthalene has a molecular weight of 236.26 g/mol, XLogP of 4.30, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-6,7-difluoronaphthalene is sourced from PubChem (CID 70812007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).