About 2-butoxy-6-fluoroaniline
2-butoxy-6-fluoroaniline (PubChem CID 60790205) has the molecular formula C10H14FNO
and a molecular weight of 183.23 g/mol. Its IUPAC name is 2-butoxy-6-fluoroaniline.
Molecular Properties
| Compound Name | 2-butoxy-6-fluoroaniline |
| PubChem CID | 60790205 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-butoxy-6-fluoroaniline |
| SMILES | CCCCOc1cccc(F)c1N |
| InChI | InChI=1S/C10H14FNO/c1-2-3-7-13-9-6-4-5-8(11)10(9)12/h4-6H,2-3,7,12H2,1H3 |
| InChIKey | JODDWQLCJVJRLU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-6-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-6-fluoroaniline?
The IUPAC name of 2-butoxy-6-fluoroaniline (CID 60790205) is 2-butoxy-6-fluoroaniline.
What is the SMILES notation for 2-butoxy-6-fluoroaniline?
The canonical SMILES for 2-butoxy-6-fluoroaniline is CCCCOc1cccc(F)c1N.
What is the InChIKey of 2-butoxy-6-fluoroaniline?
The InChIKey is JODDWQLCJVJRLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FNO/c1-2-3-7-13-9-6-4-5-8(11)10(9)12/h4-6H,2-3,7,12H2,1H3.
What are the key properties of 2-butoxy-6-fluoroaniline?
2-butoxy-6-fluoroaniline has a molecular weight of 183.23 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-6-fluoroaniline is sourced from PubChem (CID 60790205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).