About 2-amino-3-butoxybenzoic acid
2-amino-3-butoxybenzoic acid (PubChem CID 61039870) has the molecular formula C11H15NO3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-amino-3-butoxybenzoic acid.
Molecular Properties
| Compound Name | 2-amino-3-butoxybenzoic acid |
| PubChem CID | 61039870 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-amino-3-butoxybenzoic acid |
| SMILES | CCCCOc1cccc(C(=O)O)c1N |
| InChI | InChI=1S/C11H15NO3/c1-2-3-7-15-9-6-4-5-8(10(9)12)11(13)14/h4-6H,2-3,7,12H2,1H3,(H,13,14) |
| InChIKey | FKLZPOWJPWNISV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-butoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-butoxybenzoic acid?
The IUPAC name of 2-amino-3-butoxybenzoic acid (CID 61039870) is 2-amino-3-butoxybenzoic acid.
What is the SMILES notation for 2-amino-3-butoxybenzoic acid?
The canonical SMILES for 2-amino-3-butoxybenzoic acid is CCCCOc1cccc(C(=O)O)c1N.
What is the InChIKey of 2-amino-3-butoxybenzoic acid?
The InChIKey is FKLZPOWJPWNISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-2-3-7-15-9-6-4-5-8(10(9)12)11(13)14/h4-6H,2-3,7,12H2,1H3,(H,13,14).
What are the key properties of 2-amino-3-butoxybenzoic acid?
2-amino-3-butoxybenzoic acid has a molecular weight of 209.25 g/mol, XLogP of 2.15, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-butoxybenzoic acid is sourced from PubChem (CID 61039870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).