About 3-hexoxy-2-methylbenzoic acid
3-hexoxy-2-methylbenzoic acid (PubChem CID 82826739) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-hexoxy-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-hexoxy-2-methylbenzoic acid |
| PubChem CID | 82826739 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3-hexoxy-2-methylbenzoic acid |
| SMILES | CCCCCCOc1cccc(C(=O)O)c1C |
| InChI | InChI=1S/C14H20O3/c1-3-4-5-6-10-17-13-9-7-8-12(11(13)2)14(15)16/h7-9H,3-6,10H2,1-2H3,(H,15,16) |
| InChIKey | KENLWHHPFYSMPV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexoxy-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexoxy-2-methylbenzoic acid?
The IUPAC name of 3-hexoxy-2-methylbenzoic acid (CID 82826739) is 3-hexoxy-2-methylbenzoic acid.
What is the SMILES notation for 3-hexoxy-2-methylbenzoic acid?
The canonical SMILES for 3-hexoxy-2-methylbenzoic acid is CCCCCCOc1cccc(C(=O)O)c1C.
What is the InChIKey of 3-hexoxy-2-methylbenzoic acid?
The InChIKey is KENLWHHPFYSMPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-3-4-5-6-10-17-13-9-7-8-12(11(13)2)14(15)16/h7-9H,3-6,10H2,1-2H3,(H,15,16).
What are the key properties of 3-hexoxy-2-methylbenzoic acid?
3-hexoxy-2-methylbenzoic acid has a molecular weight of 236.31 g/mol, XLogP of 3.65, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexoxy-2-methylbenzoic acid is sourced from PubChem (CID 82826739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).