About 2-nonoxybenzoic acid;zinc
2-nonoxybenzoic acid;zinc (PubChem CID 70396181) has the molecular formula C16H24O3Zn
and a molecular weight of 329.75 g/mol. Its IUPAC name is 2-nonoxybenzoic acid;zinc.
Molecular Properties
| Compound Name | 2-nonoxybenzoic acid;zinc |
| PubChem CID | 70396181 |
| Molecular Formula | C16H24O3Zn |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-nonoxybenzoic acid;zinc |
| SMILES | CCCCCCCCCOc1ccccc1C(=O)O.[Zn] |
| InChI | InChI=1S/C16H24O3.Zn/c1-2-3-4-5-6-7-10-13-19-15-12-9-8-11-14(15)16(17)18;/h8-9,11-12H,2-7,10,13H2,1H3,(H,17,18); |
| InChIKey | DALNSWPMPAGCGP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-nonoxybenzoic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonoxybenzoic acid;zinc?
The IUPAC name of 2-nonoxybenzoic acid;zinc (CID 70396181) is 2-nonoxybenzoic acid;zinc.
What is the SMILES notation for 2-nonoxybenzoic acid;zinc?
The canonical SMILES for 2-nonoxybenzoic acid;zinc is CCCCCCCCCOc1ccccc1C(=O)O.[Zn].
What is the InChIKey of 2-nonoxybenzoic acid;zinc?
The InChIKey is DALNSWPMPAGCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3.Zn/c1-2-3-4-5-6-7-10-13-19-15-12-9-8-11-14(15)16(17)18;/h8-9,11-12H,2-7,10,13H2,1H3,(H,17,18);.
What are the key properties of 2-nonoxybenzoic acid;zinc?
2-nonoxybenzoic acid;zinc has a molecular weight of 329.75 g/mol, XLogP of 4.51, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonoxybenzoic acid;zinc is sourced from PubChem (CID 70396181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).