C24H30O6 — CID 168958478
3-[5-(4-butanoyl-3-hydroxy-2-methylphenoxy)pentoxy]-2-methylbenzoic acid (PubChem CID 168958478) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is 3-[5-(4-butanoyl-3-hydroxy-2-methylphenoxy)pentoxy]-2-methylbenzoic acid.
| Compound Name | 3-[5-(4-butanoyl-3-hydroxy-2-methylphenoxy)pentoxy]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 168958478 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3-[5-(4-butanoyl-3-hydroxy-2-methylphenoxy)pentoxy]-2-methylbenzoic acid |
| SMILES | CCCC(=O)c1ccc(OCCCCCOc2cccc(C(=O)O)c2C)c(C)c1O |
| InChI | InChI=1S/C24H30O6/c1-4-9-20(25)19-12-13-22(17(3)23(19)26)30-15-7-5-6-14-29-21-11-8-10-18(16(21)2)24(27)28/h8,10-13,26H,4-7,9,14-15H2,1-3H3,(H,27,28) |
| InChIKey | OVIRHTRFNGYEAU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|