C22H25ClO8S — CID 168958541
4-[2-[2-(4-butanoyl-3-hydroxy-2-methylphenoxy)ethylsulfonyl]ethoxy]-2-chlorobenzoic acid (PubChem CID 168958541) has the molecular formula C22H25ClO8S and a molecular weight of 484.95 g/mol. Its IUPAC name is 4-[2-[2-(4-butanoyl-3-hydroxy-2-methylphenoxy)ethylsulfonyl]ethoxy]-2-chlorobenzoic acid.
| Compound Name | 4-[2-[2-(4-butanoyl-3-hydroxy-2-methylphenoxy)ethylsulfonyl]ethoxy]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 168958541 |
| Molecular Formula | C22H25ClO8S |
| Molecular Weight | 484.95 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 4-[2-[2-(4-butanoyl-3-hydroxy-2-methylphenoxy)ethylsulfonyl]ethoxy]-2-chlorobenzoic acid |
| SMILES | CCCC(=O)c1ccc(OCCS(=O)(=O)CCOc2ccc(C(=O)O)c(Cl)c2)c(C)c1O |
| InChI | InChI=1S/C22H25ClO8S/c1-3-4-19(24)17-7-8-20(14(2)21(17)25)31-10-12-32(28,29)11-9-30-15-5-6-16(22(26)27)18(23)13-15/h5-8,13,25H,3-4,9-12H2,1-2H3,(H,26,27) |
| InChIKey | ZTARCJQHNDQJMC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.95 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |