C13H17ClO4 — CID 154112180
1-[2-chloro-4-(2,3-dihydroxypropoxy)phenyl]butan-1-one (PubChem CID 154112180) has the molecular formula C13H17ClO4 and a molecular weight of 272.73 g/mol. Its IUPAC name is 1-[2-chloro-4-(2,3-dihydroxypropoxy)phenyl]butan-1-one.
| Compound Name | 1-[2-chloro-4-(2,3-dihydroxypropoxy)phenyl]butan-1-one |
|---|---|
| PubChem CID | 154112180 |
| Molecular Formula | C13H17ClO4 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-[2-chloro-4-(2,3-dihydroxypropoxy)phenyl]butan-1-one |
| SMILES | CCCC(=O)c1ccc(OCC(O)CO)cc1Cl |
| InChI | InChI=1S/C13H17ClO4/c1-2-3-13(17)11-5-4-10(6-12(11)14)18-8-9(16)7-15/h4-6,9,15-16H,2-3,7-8H2,1H3 |
| InChIKey | HFNNVEVLEMTEGW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |