C12H15ClO5 — CID 106500831
2-chloro-5-(3-ethoxy-2-hydroxypropoxy)benzoic acid (PubChem CID 106500831) has the molecular formula C12H15ClO5 and a molecular weight of 274.70 g/mol. Its IUPAC name is 2-chloro-5-(3-ethoxy-2-hydroxypropoxy)benzoic acid.
| Compound Name | 2-chloro-5-(3-ethoxy-2-hydroxypropoxy)benzoic acid |
|---|---|
| PubChem CID | 106500831 |
| Molecular Formula | C12H15ClO5 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-chloro-5-(3-ethoxy-2-hydroxypropoxy)benzoic acid |
| SMILES | CCOCC(O)COc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H15ClO5/c1-2-17-6-8(14)7-18-9-3-4-11(13)10(5-9)12(15)16/h3-5,8,14H,2,6-7H2,1H3,(H,15,16) |
| InChIKey | QVXHYQZRGTZBQT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |