C19H22O9 — CID 86172123
bis[4-(2,3-dihydroxypropoxy)-2-hydroxyphenyl]methanone (PubChem CID 86172123) has the molecular formula C19H22O9 and a molecular weight of 394.38 g/mol. Its IUPAC name is bis[4-(2,3-dihydroxypropoxy)-2-hydroxyphenyl]methanone.
| Compound Name | bis[4-(2,3-dihydroxypropoxy)-2-hydroxyphenyl]methanone |
|---|---|
| PubChem CID | 86172123 |
| Molecular Formula | C19H22O9 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | bis[4-(2,3-dihydroxypropoxy)-2-hydroxyphenyl]methanone |
| SMILES | O=C(c1ccc(OCC(O)CO)cc1O)c1ccc(OCC(O)CO)cc1O |
| InChI | InChI=1S/C19H22O9/c20-7-11(22)9-27-13-1-3-15(17(24)5-13)19(26)16-4-2-14(6-18(16)25)28-10-12(23)8-21/h1-6,11-12,20-25H,7-10H2 |
| InChIKey | NEPLCNNGIBAGGV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |