C40H48O10 — CID 162086592
bis(4-butoxy-2-hydroxyphenyl)methanone;bis(2-hydroxy-4-propan-2-yloxyphenyl)methanone (PubChem CID 162086592) has the molecular formula C40H48O10 and a molecular weight of 688.81 g/mol. Its IUPAC name is bis(4-butoxy-2-hydroxyphenyl)methanone;bis(2-hydroxy-4-propan-2-yloxyphenyl)methanone.
| Compound Name | bis(4-butoxy-2-hydroxyphenyl)methanone;bis(2-hydroxy-4-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 162086592 |
| Molecular Formula | C40H48O10 |
| Molecular Weight | 688.81 g/mol |
| Exact Mass | 688.32 |
| IUPAC Name | bis(4-butoxy-2-hydroxyphenyl)methanone;bis(2-hydroxy-4-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1ccc(C(=O)c2ccc(OC(C)C)cc2O)c(O)c1.CCCCOc1ccc(C(=O)c2ccc(OCCCC)cc2O)c(O)c1 |
| InChI | InChI=1S/C21H26O5.C19H22O5/c1-3-5-11-25-15-7-9-17(19(22)13-15)21(24)18-10-8-16(14-20(18)23)26-12-6-4-2;1-11(2)23-13-5-7-15(17(20)9-13)19(22)16-8-6-14(10-18(16)21)24-12(3)4/h7-10,13-14,22-23H,3-6,11-12H2,1-2H3;5-12,20-21H,1-4H3 |
| InChIKey | ZDAVBIIVYGWKFU-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.81 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|