C19H22O4 — CID 135325809
(2-hydroxy-4-propan-2-yloxyphenyl)-(4-propoxyphenyl)methanone (PubChem CID 135325809) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2-hydroxy-4-propan-2-yloxyphenyl)-(4-propoxyphenyl)methanone.
| Compound Name | (2-hydroxy-4-propan-2-yloxyphenyl)-(4-propoxyphenyl)methanone |
|---|---|
| PubChem CID | 135325809 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (2-hydroxy-4-propan-2-yloxyphenyl)-(4-propoxyphenyl)methanone |
| SMILES | CCCOc1ccc(C(=O)c2ccc(OC(C)C)cc2O)cc1 |
| InChI | InChI=1S/C19H22O4/c1-4-11-22-15-7-5-14(6-8-15)19(21)17-10-9-16(12-18(17)20)23-13(2)3/h5-10,12-13,20H,4,11H2,1-3H3 |
| InChIKey | GYCXSOQKMCNTRI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |