C20H24O5 — CID 175697504
(4-butoxyphenyl)-(2,3-dihydroxy-4-propan-2-yloxyphenyl)methanone (PubChem CID 175697504) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (4-butoxyphenyl)-(2,3-dihydroxy-4-propan-2-yloxyphenyl)methanone.
| Compound Name | (4-butoxyphenyl)-(2,3-dihydroxy-4-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 175697504 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (4-butoxyphenyl)-(2,3-dihydroxy-4-propan-2-yloxyphenyl)methanone |
| SMILES | CCCCOc1ccc(C(=O)c2ccc(OC(C)C)c(O)c2O)cc1 |
| InChI | InChI=1S/C20H24O5/c1-4-5-12-24-15-8-6-14(7-9-15)18(21)16-10-11-17(25-13(2)3)20(23)19(16)22/h6-11,13,22-23H,4-5,12H2,1-3H3 |
| InChIKey | BGZNDPAMMYDHOG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|