C13H16Cl2O2 — CID 82627435
2,2-dichloro-1-(4-pentoxyphenyl)ethanone (PubChem CID 82627435) has the molecular formula C13H16Cl2O2 and a molecular weight of 275.18 g/mol. Its IUPAC name is 2,2-dichloro-1-(4-pentoxyphenyl)ethanone.
| Compound Name | 2,2-dichloro-1-(4-pentoxyphenyl)ethanone |
|---|---|
| PubChem CID | 82627435 |
| Molecular Formula | C13H16Cl2O2 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2,2-dichloro-1-(4-pentoxyphenyl)ethanone |
| SMILES | CCCCCOc1ccc(C(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C13H16Cl2O2/c1-2-3-4-9-17-11-7-5-10(6-8-11)12(16)13(14)15/h5-8,13H,2-4,9H2,1H3 |
| InChIKey | CMJSKKGDURPGND-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|