C22H28O4 — CID 135325812
(3,5-dipropoxyphenyl)-(4-propoxyphenyl)methanone (PubChem CID 135325812) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (3,5-dipropoxyphenyl)-(4-propoxyphenyl)methanone.
| Compound Name | (3,5-dipropoxyphenyl)-(4-propoxyphenyl)methanone |
|---|---|
| PubChem CID | 135325812 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (3,5-dipropoxyphenyl)-(4-propoxyphenyl)methanone |
| SMILES | CCCOc1ccc(C(=O)c2cc(OCCC)cc(OCCC)c2)cc1 |
| InChI | InChI=1S/C22H28O4/c1-4-11-24-19-9-7-17(8-10-19)22(23)18-14-20(25-12-5-2)16-21(15-18)26-13-6-3/h7-10,14-16H,4-6,11-13H2,1-3H3 |
| InChIKey | AWOYZPZQWIKWBA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |