About [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate
[4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate (PubChem CID 58981515) has the molecular formula C25H22O7
and a molecular weight of 434.44 g/mol. Its IUPAC name is [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate.
Molecular Properties
| Compound Name | [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate |
| PubChem CID | 58981515 |
| Molecular Formula | C25H22O7 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(OC(C)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H22O7/c1-3-16-29-20-8-4-18(5-9-20)24(27)31-22-10-6-19(7-11-22)25(28)32-23-14-12-21(13-15-23)30-17(2)26/h4-15H,3,16H2,1-2H3 |
| InChIKey | YZKUAYNSPMUASS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate?
The IUPAC name of [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate (CID 58981515) is [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate.
What is the SMILES notation for [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate?
The canonical SMILES for [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate is CCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(OC(C)=O)cc3)cc2)cc1.
What is the InChIKey of [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate?
The InChIKey is YZKUAYNSPMUASS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O7/c1-3-16-29-20-8-4-18(5-9-20)24(27)31-22-10-6-19(7-11-22)25(28)32-23-14-12-21(13-15-23)30-17(2)26/h4-15H,3,16H2,1-2H3.
What are the key properties of [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate?
[4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate has a molecular weight of 434.44 g/mol, XLogP of 4.84, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-acetyloxyphenoxy)carbonylphenyl] 4-propoxybenzoate is sourced from PubChem (CID 58981515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).