C15H14O5 — CID 23069395
(2,4-dihydroxyphenyl)-(4-ethoxy-2-hydroxyphenyl)methanone (PubChem CID 23069395) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is (2,4-dihydroxyphenyl)-(4-ethoxy-2-hydroxyphenyl)methanone.
| Compound Name | (2,4-dihydroxyphenyl)-(4-ethoxy-2-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 23069395 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (2,4-dihydroxyphenyl)-(4-ethoxy-2-hydroxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)c2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C15H14O5/c1-2-20-10-4-6-12(14(18)8-10)15(19)11-5-3-9(16)7-13(11)17/h3-8,16-18H,2H2,1H3 |
| InChIKey | XPKZXNJNXKJNAE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |