C18H20N2O6 — CID 20557201
4-ethoxy-N'-(4-ethoxy-2-hydroxybenzoyl)-2-hydroxybenzohydrazide (PubChem CID 20557201) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 4-ethoxy-N'-(4-ethoxy-2-hydroxybenzoyl)-2-hydroxybenzohydrazide.
| Compound Name | 4-ethoxy-N'-(4-ethoxy-2-hydroxybenzoyl)-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 20557201 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 4-ethoxy-N'-(4-ethoxy-2-hydroxybenzoyl)-2-hydroxybenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2ccc(OCC)cc2O)c(O)c1 |
| InChI | InChI=1S/C18H20N2O6/c1-3-25-11-5-7-13(15(21)9-11)17(23)19-20-18(24)14-8-6-12(26-4-2)10-16(14)22/h5-10,21-22H,3-4H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | SOBASUINTYFDDB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|