C17H18N2O4 — CID 51193302
2-hydroxy-4-methyl-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide (PubChem CID 51193302) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide.
| Compound Name | 2-hydroxy-4-methyl-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 51193302 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-hydroxy-4-methyl-N'-[2-(3-methylphenoxy)acetyl]benzohydrazide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)c2ccc(C)cc2O)c1 |
| InChI | InChI=1S/C17H18N2O4/c1-11-4-3-5-13(8-11)23-10-16(21)18-19-17(22)14-7-6-12(2)9-15(14)20/h3-9,20H,10H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | IDTFJBPRYGQVJU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|