C16H15BrN2O4 — CID 27163290
5-bromo-N'-(4-ethoxybenzoyl)-2-hydroxybenzohydrazide (PubChem CID 27163290) has the molecular formula C16H15BrN2O4 and a molecular weight of 379.21 g/mol. Its IUPAC name is 5-bromo-N'-(4-ethoxybenzoyl)-2-hydroxybenzohydrazide.
| Compound Name | 5-bromo-N'-(4-ethoxybenzoyl)-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 27163290 |
| Molecular Formula | C16H15BrN2O4 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 5-bromo-N'-(4-ethoxybenzoyl)-2-hydroxybenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C16H15BrN2O4/c1-2-23-12-6-3-10(4-7-12)15(21)18-19-16(22)13-9-11(17)5-8-14(13)20/h3-9,20H,2H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | ROCPZMGZJGTHOA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|