C24H23BrN2O5 — CID 2461548
2-bromo-N'-[4-[(4-ethoxyphenoxy)methyl]benzoyl]-5-methoxybenzohydrazide (PubChem CID 2461548) has the molecular formula C24H23BrN2O5 and a molecular weight of 499.36 g/mol. Its IUPAC name is 2-bromo-N'-[4-[(4-ethoxyphenoxy)methyl]benzoyl]-5-methoxybenzohydrazide.
| Compound Name | 2-bromo-N'-[4-[(4-ethoxyphenoxy)methyl]benzoyl]-5-methoxybenzohydrazide |
|---|---|
| PubChem CID | 2461548 |
| Molecular Formula | C24H23BrN2O5 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 2-bromo-N'-[4-[(4-ethoxyphenoxy)methyl]benzoyl]-5-methoxybenzohydrazide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)NNC(=O)c3cc(OC)ccc3Br)cc2)cc1 |
| InChI | InChI=1S/C24H23BrN2O5/c1-3-31-18-8-10-19(11-9-18)32-15-16-4-6-17(7-5-16)23(28)26-27-24(29)21-14-20(30-2)12-13-22(21)25/h4-14H,3,15H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | YSCBQYXDIDSWQD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|