C16H14O5 — CID 156787374
2-(4-ethoxy-2-hydroxybenzoyl)benzoic acid (PubChem CID 156787374) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-(4-ethoxy-2-hydroxybenzoyl)benzoic acid.
| Compound Name | 2-(4-ethoxy-2-hydroxybenzoyl)benzoic acid |
|---|---|
| PubChem CID | 156787374 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-(4-ethoxy-2-hydroxybenzoyl)benzoic acid |
| SMILES | CCOc1ccc(C(=O)c2ccccc2C(=O)O)c(O)c1 |
| InChI | InChI=1S/C16H14O5/c1-2-21-10-7-8-13(14(17)9-10)15(18)11-5-3-4-6-12(11)16(19)20/h3-9,17H,2H2,1H3,(H,19,20) |
| InChIKey | YBGZGJPWWNMWST-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |